C17H18Br2FN — CID 63521897
2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-bromophenyl)-N-methylpropan-1-amine (PubChem CID 63521897) has the molecular formula C17H18Br2FN and a molecular weight of 415.14 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-bromophenyl)-N-methylpropan-1-amine.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-bromophenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 63521897 |
| Molecular Formula | C17H18Br2FN |
| Molecular Weight | 415.14 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methyl]-3-(4-bromophenyl)-N-methylpropan-1-amine |
| SMILES | CNCC(Cc1ccc(Br)cc1)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C17H18Br2FN/c1-21-11-13(8-12-2-4-15(18)5-3-12)9-14-10-16(20)6-7-17(14)19/h2-7,10,13,21H,8-9,11H2,1H3 |
| InChIKey | WIAKPLHUWYDWAF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.14 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |