C12H13BrFNO2S — CID 82906331
4-[(2-bromo-4-fluorophenyl)methyl]thiomorpholine-3-carboxylic acid (PubChem CID 82906331) has the molecular formula C12H13BrFNO2S and a molecular weight of 334.21 g/mol. Its IUPAC name is 4-[(2-bromo-4-fluorophenyl)methyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(2-bromo-4-fluorophenyl)methyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82906331 |
| Molecular Formula | C12H13BrFNO2S |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 4-[(2-bromo-4-fluorophenyl)methyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C12H13BrFNO2S/c13-10-5-9(14)2-1-8(10)6-15-3-4-18-7-11(15)12(16)17/h1-2,5,11H,3-4,6-7H2,(H,16,17) |
| InChIKey | OGUPJEYUNGUJRF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |