C13H15F2NO3S — CID 82909459
4-[[2-(difluoromethoxy)phenyl]methyl]thiomorpholine-3-carboxylic acid (PubChem CID 82909459) has the molecular formula C13H15F2NO3S and a molecular weight of 303.33 g/mol. Its IUPAC name is 4-[[2-(difluoromethoxy)phenyl]methyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[[2-(difluoromethoxy)phenyl]methyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82909459 |
| Molecular Formula | C13H15F2NO3S |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-[[2-(difluoromethoxy)phenyl]methyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H15F2NO3S/c14-13(15)19-11-4-2-1-3-9(11)7-16-5-6-20-8-10(16)12(17)18/h1-4,10,13H,5-8H2,(H,17,18) |
| InChIKey | GHUKWNULBUROHI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |