C13H15F2NO4 — CID 114351798
1-[[2-(difluoromethoxy)phenyl]methyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 114351798) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114351798 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H15F2NO4/c14-13(15)20-11-4-2-1-3-8(11)6-16-7-9(17)5-10(16)12(18)19/h1-4,9-10,13,17H,5-7H2,(H,18,19) |
| InChIKey | YYWADODRELKVLB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |