C13H17NO4 — CID 14472500
4-hydroxy-1-(2-hydroxy-2-phenylethyl)pyrrolidine-2-carboxylic acid (PubChem CID 14472500) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-hydroxy-1-(2-hydroxy-2-phenylethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-(2-hydroxy-2-phenylethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14472500 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-hydroxy-1-(2-hydroxy-2-phenylethyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1CC(O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c15-10-6-11(13(17)18)14(7-10)8-12(16)9-4-2-1-3-5-9/h1-5,10-12,15-16H,6-8H2,(H,17,18) |
| InChIKey | BEHKTOMARLIXPS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |