C13H16N2O6S — CID 91448561
4-hydroxy-1-[2-nitroso-3-oxo-3-(thiophen-2-ylmethoxy)propyl]pyrrolidine-2-carboxylic acid (PubChem CID 91448561) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is 4-hydroxy-1-[2-nitroso-3-oxo-3-(thiophen-2-ylmethoxy)propyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-[2-nitroso-3-oxo-3-(thiophen-2-ylmethoxy)propyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91448561 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-hydroxy-1-[2-nitroso-3-oxo-3-(thiophen-2-ylmethoxy)propyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=NC(CN1CC(O)CC1C(=O)O)C(=O)OCc1cccs1 |
| InChI | InChI=1S/C13H16N2O6S/c16-8-4-11(12(17)18)15(5-8)6-10(14-20)13(19)21-7-9-2-1-3-22-9/h1-3,8,10-11,16H,4-7H2,(H,17,18) |
| InChIKey | NIVKUOPGQBAVAF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |