C11H15NO2S — CID 66031603
thiophen-2-ylmethyl 3-aminocyclopentane-1-carboxylate (PubChem CID 66031603) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is thiophen-2-ylmethyl 3-aminocyclopentane-1-carboxylate.
| Compound Name | thiophen-2-ylmethyl 3-aminocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 66031603 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | thiophen-2-ylmethyl 3-aminocyclopentane-1-carboxylate |
| SMILES | NC1CCC(C(=O)OCc2cccs2)C1 |
| InChI | InChI=1S/C11H15NO2S/c12-9-4-3-8(6-9)11(13)14-7-10-2-1-5-15-10/h1-2,5,8-9H,3-4,6-7,12H2 |
| InChIKey | IERSSFQLJPPMGR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |