C7H12FNO3 — CID 114351489
1-(2-fluoroethyl)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 114351489) has the molecular formula C7H12FNO3 and a molecular weight of 177.17 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-fluoroethyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114351489 |
| Molecular Formula | C7H12FNO3 |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 1-(2-fluoroethyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1CCF |
| InChI | InChI=1S/C7H12FNO3/c8-1-2-9-4-5(10)3-6(9)7(11)12/h5-6,10H,1-4H2,(H,11,12) |
| InChIKey | NPRRWAJJVSYVRE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |