C9H16FNO2 — CID 114426285
1-(2-fluoroethyl)-4-methylpiperidine-2-carboxylic acid (PubChem CID 114426285) has the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-(2-fluoroethyl)-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114426285 |
| Molecular Formula | C9H16FNO2 |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(2-fluoroethyl)-4-methylpiperidine-2-carboxylic acid |
| SMILES | CC1CCN(CCF)C(C(=O)O)C1 |
| InChI | InChI=1S/C9H16FNO2/c1-7-2-4-11(5-3-10)8(6-7)9(12)13/h7-8H,2-6H2,1H3,(H,12,13) |
| InChIKey | UPNMOZPAKOMZFK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |