C11H17NO2 — CID 114426543
1-but-3-ynyl-4-methylpiperidine-2-carboxylic acid (PubChem CID 114426543) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-but-3-ynyl-4-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-but-3-ynyl-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114426543 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-but-3-ynyl-4-methylpiperidine-2-carboxylic acid |
| SMILES | C#CCCN1CCC(C)CC1C(=O)O |
| InChI | InChI=1S/C11H17NO2/c1-3-4-6-12-7-5-9(2)8-10(12)11(13)14/h1,9-10H,4-8H2,2H3,(H,13,14) |
| InChIKey | PAJDEVIEIIENJB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|