C12H15FOS2 — CID 79973042
1,4-dithian-2-yl-(3-fluoro-5-methylphenyl)methanol (PubChem CID 79973042) has the molecular formula C12H15FOS2 and a molecular weight of 258.38 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(3-fluoro-5-methylphenyl)methanol.
| Compound Name | 1,4-dithian-2-yl-(3-fluoro-5-methylphenyl)methanol |
|---|---|
| PubChem CID | 79973042 |
| Molecular Formula | C12H15FOS2 |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1,4-dithian-2-yl-(3-fluoro-5-methylphenyl)methanol |
| SMILES | Cc1cc(F)cc(C(O)C2CSCCS2)c1 |
| InChI | InChI=1S/C12H15FOS2/c1-8-4-9(6-10(13)5-8)12(14)11-7-15-2-3-16-11/h4-6,11-12,14H,2-3,7H2,1H3 |
| InChIKey | OZWYCQSWRXJRFY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |