C12H15FO2S2 — CID 79973431
1,4-dithian-2-yl-(3-fluoro-4-methoxyphenyl)methanol (PubChem CID 79973431) has the molecular formula C12H15FO2S2 and a molecular weight of 274.38 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(3-fluoro-4-methoxyphenyl)methanol.
| Compound Name | 1,4-dithian-2-yl-(3-fluoro-4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 79973431 |
| Molecular Formula | C12H15FO2S2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1,4-dithian-2-yl-(3-fluoro-4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)C2CSCCS2)cc1F |
| InChI | InChI=1S/C12H15FO2S2/c1-15-10-3-2-8(6-9(10)13)12(14)11-7-16-4-5-17-11/h2-3,6,11-12,14H,4-5,7H2,1H3 |
| InChIKey | KLZQTXOMTKQVOQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |