C14H17F3O2 — CID 105095417
(4,4-difluorocyclohexyl)-(3-fluoro-4-methoxyphenyl)methanol (PubChem CID 105095417) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(3-fluoro-4-methoxyphenyl)methanol.
| Compound Name | (4,4-difluorocyclohexyl)-(3-fluoro-4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 105095417 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(3-fluoro-4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)C2CCC(F)(F)CC2)cc1F |
| InChI | InChI=1S/C14H17F3O2/c1-19-12-3-2-10(8-11(12)15)13(18)9-4-6-14(16,17)7-5-9/h2-3,8-9,13,18H,4-7H2,1H3 |
| InChIKey | YBVDTPUNUIZGFQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |