C17H24F2O — CID 105091802
(4-tert-butylphenyl)-(4,4-difluorocyclohexyl)methanol (PubChem CID 105091802) has the molecular formula C17H24F2O and a molecular weight of 282.37 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(4,4-difluorocyclohexyl)methanol.
| Compound Name | (4-tert-butylphenyl)-(4,4-difluorocyclohexyl)methanol |
|---|---|
| PubChem CID | 105091802 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (4-tert-butylphenyl)-(4,4-difluorocyclohexyl)methanol |
| SMILES | CC(C)(C)c1ccc(C(O)C2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C17H24F2O/c1-16(2,3)14-6-4-12(5-7-14)15(20)13-8-10-17(18,19)11-9-13/h4-7,13,15,20H,8-11H2,1-3H3 |
| InChIKey | NWMBAXDUBMALKR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |