C15H20F2O3 — CID 105131631
(4,4-difluorocyclohexyl)-(2,6-dimethoxyphenyl)methanol (PubChem CID 105131631) has the molecular formula C15H20F2O3 and a molecular weight of 286.32 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(2,6-dimethoxyphenyl)methanol.
| Compound Name | (4,4-difluorocyclohexyl)-(2,6-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 105131631 |
| Molecular Formula | C15H20F2O3 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(2,6-dimethoxyphenyl)methanol |
| SMILES | COc1cccc(OC)c1C(O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H20F2O3/c1-19-11-4-3-5-12(20-2)13(11)14(18)10-6-8-15(16,17)9-7-10/h3-5,10,14,18H,6-9H2,1-2H3 |
| InChIKey | VMIGKPHQPBUCBX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |