C16H22F2O2 — CID 105083584
1-(4,4-difluorocyclohexyl)-2-(2-methoxy-5-methylphenyl)ethanol (PubChem CID 105083584) has the molecular formula C16H22F2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-(2-methoxy-5-methylphenyl)ethanol.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-(2-methoxy-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 105083584 |
| Molecular Formula | C16H22F2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-(2-methoxy-5-methylphenyl)ethanol |
| SMILES | COc1ccc(C)cc1CC(O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H22F2O2/c1-11-3-4-15(20-2)13(9-11)10-14(19)12-5-7-16(17,18)8-6-12/h3-4,9,12,14,19H,5-8,10H2,1-2H3 |
| InChIKey | OZMNNIQVDSKDHI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |