C13H18O — CID 61481966
1-cyclopropyl-2-(2,5-dimethylphenyl)ethanol (PubChem CID 61481966) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,5-dimethylphenyl)ethanol.
| Compound Name | 1-cyclopropyl-2-(2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 61481966 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-cyclopropyl-2-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(CC(O)C2CC2)c1 |
| InChI | InChI=1S/C13H18O/c1-9-3-4-10(2)12(7-9)8-13(14)11-5-6-11/h3-4,7,11,13-14H,5-6,8H2,1-2H3 |
| InChIKey | KKVABDWWNMQESY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |