C15H23N — CID 83154335
3-cyclopropyl-1-(2,5-dimethylphenyl)butan-2-amine (PubChem CID 83154335) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,5-dimethylphenyl)butan-2-amine.
| Compound Name | 3-cyclopropyl-1-(2,5-dimethylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 83154335 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-cyclopropyl-1-(2,5-dimethylphenyl)butan-2-amine |
| SMILES | Cc1ccc(C)c(CC(N)C(C)C2CC2)c1 |
| InChI | InChI=1S/C15H23N/c1-10-4-5-11(2)14(8-10)9-15(16)12(3)13-6-7-13/h4-5,8,12-13,15H,6-7,9,16H2,1-3H3 |
| InChIKey | BZQJTVLVCJGKSK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |