C14H21NS — CID 105101180
2-(2,5-dimethylphenyl)-1-(thiolan-3-yl)ethanamine (PubChem CID 105101180) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1-(thiolan-3-yl)ethanamine.
| Compound Name | 2-(2,5-dimethylphenyl)-1-(thiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 105101180 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1-(thiolan-3-yl)ethanamine |
| SMILES | Cc1ccc(C)c(CC(N)C2CCSC2)c1 |
| InChI | InChI=1S/C14H21NS/c1-10-3-4-11(2)13(7-10)8-14(15)12-5-6-16-9-12/h3-4,7,12,14H,5-6,8-9,15H2,1-2H3 |
| InChIKey | MPSDPFMWFOXWOA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |