C15H23N — CID 62539513
1-cyclobutyl-2-(2,5-dimethylphenyl)-N-methylethanamine (PubChem CID 62539513) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-cyclobutyl-2-(2,5-dimethylphenyl)-N-methylethanamine.
| Compound Name | 1-cyclobutyl-2-(2,5-dimethylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 62539513 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-cyclobutyl-2-(2,5-dimethylphenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cc(C)ccc1C)C1CCC1 |
| InChI | InChI=1S/C15H23N/c1-11-7-8-12(2)14(9-11)10-15(16-3)13-5-4-6-13/h7-9,13,15-16H,4-6,10H2,1-3H3 |
| InChIKey | NMCFBKQIYPEXDT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |