C17H27NOS — CID 104754430
1-cyclohexyl-2-(2,5-dimethylphenyl)sulfinyl-N-methylethanamine (PubChem CID 104754430) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,5-dimethylphenyl)sulfinyl-N-methylethanamine.
| Compound Name | 1-cyclohexyl-2-(2,5-dimethylphenyl)sulfinyl-N-methylethanamine |
|---|---|
| PubChem CID | 104754430 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-cyclohexyl-2-(2,5-dimethylphenyl)sulfinyl-N-methylethanamine |
| SMILES | CNC(CS(=O)c1cc(C)ccc1C)C1CCCCC1 |
| InChI | InChI=1S/C17H27NOS/c1-13-9-10-14(2)17(11-13)20(19)12-16(18-3)15-7-5-4-6-8-15/h9-11,15-16,18H,4-8,12H2,1-3H3 |
| InChIKey | OPIFIPQUNGEKID-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |