C14H16BrF3O — CID 105088370
2-(2-bromo-5-fluorophenyl)-1-(4,4-difluorocyclohexyl)ethanol (PubChem CID 105088370) has the molecular formula C14H16BrF3O and a molecular weight of 337.18 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-1-(4,4-difluorocyclohexyl)ethanol.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-1-(4,4-difluorocyclohexyl)ethanol |
|---|---|
| PubChem CID | 105088370 |
| Molecular Formula | C14H16BrF3O |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-1-(4,4-difluorocyclohexyl)ethanol |
| SMILES | OC(Cc1cc(F)ccc1Br)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H16BrF3O/c15-12-2-1-11(16)7-10(12)8-13(19)9-3-5-14(17,18)6-4-9/h1-2,7,9,13,19H,3-6,8H2 |
| InChIKey | VWIISVPNPIYWBY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |