C17H24BrFO — CID 65151763
1-[(2-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-ol (PubChem CID 65151763) has the molecular formula C17H24BrFO and a molecular weight of 343.28 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-ol.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-ol |
|---|---|
| PubChem CID | 65151763 |
| Molecular Formula | C17H24BrFO |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-ol |
| SMILES | CC(C)C1CCCC(O)(Cc2cc(F)ccc2Br)CC1 |
| InChI | InChI=1S/C17H24BrFO/c1-12(2)13-4-3-8-17(20,9-7-13)11-14-10-15(19)5-6-16(14)18/h5-6,10,12-13,20H,3-4,7-9,11H2,1-2H3 |
| InChIKey | ARVFRPQMPVQCMK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |