C16H22BrFO — CID 79701739
1-[(3-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol (PubChem CID 79701739) has the molecular formula C16H22BrFO and a molecular weight of 329.25 g/mol. Its IUPAC name is 1-[(3-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol.
| Compound Name | 1-[(3-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 79701739 |
| Molecular Formula | C16H22BrFO |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-[(3-bromo-5-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C1CCC(O)(Cc2cc(F)cc(Br)c2)CC1 |
| InChI | InChI=1S/C16H22BrFO/c1-11(2)13-3-5-16(19,6-4-13)10-12-7-14(17)9-15(18)8-12/h7-9,11,13,19H,3-6,10H2,1-2H3 |
| InChIKey | IHYKXGNDLOWDOQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |