C15H20BrFO — CID 65151801
1-[(2-bromo-4-fluorophenyl)methyl]-4-methylcycloheptan-1-ol (PubChem CID 65151801) has the molecular formula C15H20BrFO and a molecular weight of 315.23 g/mol. Its IUPAC name is 1-[(2-bromo-4-fluorophenyl)methyl]-4-methylcycloheptan-1-ol.
| Compound Name | 1-[(2-bromo-4-fluorophenyl)methyl]-4-methylcycloheptan-1-ol |
|---|---|
| PubChem CID | 65151801 |
| Molecular Formula | C15H20BrFO |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-[(2-bromo-4-fluorophenyl)methyl]-4-methylcycloheptan-1-ol |
| SMILES | CC1CCCC(O)(Cc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C15H20BrFO/c1-11-3-2-7-15(18,8-6-11)10-12-4-5-13(17)9-14(12)16/h4-5,9,11,18H,2-3,6-8,10H2,1H3 |
| InChIKey | SDOLSQUINLUYSG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |