C13H16BrFO2 — CID 65149577
4-[(2-bromo-4-fluorophenyl)methyl]-2-methyloxan-4-ol (PubChem CID 65149577) has the molecular formula C13H16BrFO2 and a molecular weight of 303.17 g/mol. Its IUPAC name is 4-[(2-bromo-4-fluorophenyl)methyl]-2-methyloxan-4-ol.
| Compound Name | 4-[(2-bromo-4-fluorophenyl)methyl]-2-methyloxan-4-ol |
|---|---|
| PubChem CID | 65149577 |
| Molecular Formula | C13H16BrFO2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 4-[(2-bromo-4-fluorophenyl)methyl]-2-methyloxan-4-ol |
| SMILES | CC1CC(O)(Cc2ccc(F)cc2Br)CCO1 |
| InChI | InChI=1S/C13H16BrFO2/c1-9-7-13(16,4-5-17-9)8-10-2-3-11(15)6-12(10)14/h2-3,6,9,16H,4-5,7-8H2,1H3 |
| InChIKey | NSBHWBLGXPGVOD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |