C14H19FO — CID 114346880
1-[(4-fluoro-2-methylphenyl)methyl]-3-methylcyclopentan-1-ol (PubChem CID 114346880) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is 1-[(4-fluoro-2-methylphenyl)methyl]-3-methylcyclopentan-1-ol.
| Compound Name | 1-[(4-fluoro-2-methylphenyl)methyl]-3-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 114346880 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-[(4-fluoro-2-methylphenyl)methyl]-3-methylcyclopentan-1-ol |
| SMILES | Cc1cc(F)ccc1CC1(O)CCC(C)C1 |
| InChI | InChI=1S/C14H19FO/c1-10-5-6-14(16,8-10)9-12-3-4-13(15)7-11(12)2/h3-4,7,10,16H,5-6,8-9H2,1-2H3 |
| InChIKey | NAZQBPYWVVCXHU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |