C13H16ClFO — CID 112653078
1-[(2-chloro-3-fluorophenyl)methyl]-3-methylcyclopentan-1-ol (PubChem CID 112653078) has the molecular formula C13H16ClFO and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-[(2-chloro-3-fluorophenyl)methyl]-3-methylcyclopentan-1-ol.
| Compound Name | 1-[(2-chloro-3-fluorophenyl)methyl]-3-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 112653078 |
| Molecular Formula | C13H16ClFO |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-[(2-chloro-3-fluorophenyl)methyl]-3-methylcyclopentan-1-ol |
| SMILES | CC1CCC(O)(Cc2cccc(F)c2Cl)C1 |
| InChI | InChI=1S/C13H16ClFO/c1-9-5-6-13(16,7-9)8-10-3-2-4-11(15)12(10)14/h2-4,9,16H,5-8H2,1H3 |
| InChIKey | AYMHPDVUMFDMSH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |