C14H15ClF4O — CID 115983401
1-[(2-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 115983401) has the molecular formula C14H15ClF4O and a molecular weight of 310.72 g/mol. Its IUPAC name is 1-[(2-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[(2-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 115983401 |
| Molecular Formula | C14H15ClF4O |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-[(2-chloro-3-fluorophenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(Cc2cccc(F)c2Cl)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H15ClF4O/c15-12-9(2-1-3-11(12)16)8-13(20)6-4-10(5-7-13)14(17,18)19/h1-3,10,20H,4-8H2 |
| InChIKey | OHRSEQIRGGHKDT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |