C18H26ClFO — CID 63406990
1-[(2-chloro-6-fluorophenyl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol (PubChem CID 63406990) has the molecular formula C18H26ClFO and a molecular weight of 312.86 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 63406990 |
| Molecular Formula | C18H26ClFO |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
| SMILES | CCC(C)(C)C1CCC(O)(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H26ClFO/c1-4-17(2,3)13-8-10-18(21,11-9-13)12-14-15(19)6-5-7-16(14)20/h5-7,13,21H,4,8-12H2,1-3H3 |
| InChIKey | AWBUTRICIPHUHJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |