C16H22ClFO — CID 55188464
1-[(2-chloro-6-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol (PubChem CID 55188464) has the molecular formula C16H22ClFO and a molecular weight of 284.80 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 55188464 |
| Molecular Formula | C16H22ClFO |
| Molecular Weight | 284.80 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C1CCC(O)(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClFO/c1-11(2)12-6-8-16(19,9-7-12)10-13-14(17)4-3-5-15(13)18/h3-5,11-12,19H,6-10H2,1-2H3 |
| InChIKey | GIVNYQZXQCFBKZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |