C17H24ClFO — CID 65090912
1-[(2-chloro-6-fluorophenyl)methyl]-4-propylcycloheptan-1-ol (PubChem CID 65090912) has the molecular formula C17H24ClFO and a molecular weight of 298.83 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-4-propylcycloheptan-1-ol.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-propylcycloheptan-1-ol |
|---|---|
| PubChem CID | 65090912 |
| Molecular Formula | C17H24ClFO |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-4-propylcycloheptan-1-ol |
| SMILES | CCCC1CCCC(O)(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClFO/c1-2-5-13-6-4-10-17(20,11-9-13)12-14-15(18)7-3-8-16(14)19/h3,7-8,13,20H,2,4-6,9-12H2,1H3 |
| InChIKey | LZBLTYAOKQLBED-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |