C16H22Cl2O — CID 107307327
1-[(2,3-dichlorophenyl)methyl]-4-propylcyclohexan-1-ol (PubChem CID 107307327) has the molecular formula C16H22Cl2O and a molecular weight of 301.26 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-4-propylcyclohexan-1-ol.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-4-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 107307327 |
| Molecular Formula | C16H22Cl2O |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-4-propylcyclohexan-1-ol |
| SMILES | CCCC1CCC(O)(Cc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C16H22Cl2O/c1-2-4-12-7-9-16(19,10-8-12)11-13-5-3-6-14(17)15(13)18/h3,5-6,12,19H,2,4,7-11H2,1H3 |
| InChIKey | RPCHMWZJOQCDGO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |