C13H16BrFO — CID 65153621
1-[(5-bromo-2-fluorophenyl)methyl]-3-methylcyclopentan-1-ol (PubChem CID 65153621) has the molecular formula C13H16BrFO and a molecular weight of 287.17 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methyl]-3-methylcyclopentan-1-ol.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 65153621 |
| Molecular Formula | C13H16BrFO |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-methylcyclopentan-1-ol |
| SMILES | CC1CCC(O)(Cc2cc(Br)ccc2F)C1 |
| InChI | InChI=1S/C13H16BrFO/c1-9-4-5-13(16,7-9)8-10-6-11(14)2-3-12(10)15/h2-3,6,9,16H,4-5,7-8H2,1H3 |
| InChIKey | PIZIAGZFPGNXHK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |