C19H22O2 — CID 63078954
2-(2-methoxy-5-methylphenyl)-1-(1-phenylcyclopropyl)ethanol (PubChem CID 63078954) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylphenyl)-1-(1-phenylcyclopropyl)ethanol.
| Compound Name | 2-(2-methoxy-5-methylphenyl)-1-(1-phenylcyclopropyl)ethanol |
|---|---|
| PubChem CID | 63078954 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-(2-methoxy-5-methylphenyl)-1-(1-phenylcyclopropyl)ethanol |
| SMILES | COc1ccc(C)cc1CC(O)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22O2/c1-14-8-9-17(21-2)15(12-14)13-18(20)19(10-11-19)16-6-4-3-5-7-16/h3-9,12,18,20H,10-11,13H2,1-2H3 |
| InChIKey | TYFPFZUJBNHDBM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |