C12H15ClFNS2 — CID 112653875
2-(2-chloro-3-fluorophenyl)-1-(1,4-dithian-2-yl)ethanamine (PubChem CID 112653875) has the molecular formula C12H15ClFNS2 and a molecular weight of 291.84 g/mol. Its IUPAC name is 2-(2-chloro-3-fluorophenyl)-1-(1,4-dithian-2-yl)ethanamine.
| Compound Name | 2-(2-chloro-3-fluorophenyl)-1-(1,4-dithian-2-yl)ethanamine |
|---|---|
| PubChem CID | 112653875 |
| Molecular Formula | C12H15ClFNS2 |
| Molecular Weight | 291.84 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-(2-chloro-3-fluorophenyl)-1-(1,4-dithian-2-yl)ethanamine |
| SMILES | NC(Cc1cccc(F)c1Cl)C1CSCCS1 |
| InChI | InChI=1S/C12H15ClFNS2/c13-12-8(2-1-3-9(12)14)6-10(15)11-7-16-4-5-17-11/h1-3,10-11H,4-7,15H2 |
| InChIKey | GBHXTABAUVAJQV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.84 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |