About 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane
2-[(2,3-difluorophenyl)-fluoromethyl]thiolane (PubChem CID 174584400) has the molecular formula C11H11F3S
and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane.
Molecular Properties
| Compound Name | 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane |
| PubChem CID | 174584400 |
| Molecular Formula | C11H11F3S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane |
| SMILES | Fc1cccc(C(F)C2CCCS2)c1F |
| InChI | InChI=1S/C11H11F3S/c12-8-4-1-3-7(10(8)13)11(14)9-5-2-6-15-9/h1,3-4,9,11H,2,5-6H2 |
| InChIKey | LWKQVYJFGIQVSN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane?
The IUPAC name of 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane (CID 174584400) is 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane.
What is the SMILES notation for 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane?
The canonical SMILES for 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane is Fc1cccc(C(F)C2CCCS2)c1F.
What is the InChIKey of 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane?
The InChIKey is LWKQVYJFGIQVSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3S/c12-8-4-1-3-7(10(8)13)11(14)9-5-2-6-15-9/h1,3-4,9,11H,2,5-6H2.
What are the key properties of 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane?
2-[(2,3-difluorophenyl)-fluoromethyl]thiolane has a molecular weight of 232.27 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane is sourced from PubChem (CID 174584400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).