C11H11F3S — CID 174584400
2-[(2,3-difluorophenyl)-fluoromethyl]thiolane (PubChem CID 174584400) has the molecular formula C11H11F3S and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane.
| Compound Name | 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane |
|---|---|
| PubChem CID | 174584400 |
| Molecular Formula | C11H11F3S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-[(2,3-difluorophenyl)-fluoromethyl]thiolane |
| SMILES | Fc1cccc(C(F)C2CCCS2)c1F |
| InChI | InChI=1S/C11H11F3S/c12-8-4-1-3-7(10(8)13)11(14)9-5-2-6-15-9/h1,3-4,9,11H,2,5-6H2 |
| InChIKey | LWKQVYJFGIQVSN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |