C11H13Cl2NS — CID 80623174
(2,3-dichlorophenyl)-(thiolan-2-yl)methanamine (PubChem CID 80623174) has the molecular formula C11H13Cl2NS and a molecular weight of 262.20 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(thiolan-2-yl)methanamine.
| Compound Name | (2,3-dichlorophenyl)-(thiolan-2-yl)methanamine |
|---|---|
| PubChem CID | 80623174 |
| Molecular Formula | C11H13Cl2NS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | (2,3-dichlorophenyl)-(thiolan-2-yl)methanamine |
| SMILES | NC(c1cccc(Cl)c1Cl)C1CCCS1 |
| InChI | InChI=1S/C11H13Cl2NS/c12-8-4-1-3-7(10(8)13)11(14)9-5-2-6-15-9/h1,3-4,9,11H,2,5-6,14H2 |
| InChIKey | YSADNQULAOWEIH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |