C17H15NO2S — CID 106601335
1-benzofuran-2-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanamine (PubChem CID 106601335) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-benzofuran-2-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanamine.
| Compound Name | 1-benzofuran-2-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanamine |
|---|---|
| PubChem CID | 106601335 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-benzofuran-2-yl(2,3-dihydro-1,4-benzoxathiin-2-yl)methanamine |
| SMILES | NC(c1cc2ccccc2o1)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C17H15NO2S/c18-17(14-9-11-5-1-2-6-12(11)19-14)15-10-21-16-8-4-3-7-13(16)20-15/h1-9,15,17H,10,18H2 |
| InChIKey | YNKKJMWDSNKQIB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |