C18H17NO — CID 114729328
1-benzofuran-2-yl(2,3-dihydro-1H-inden-1-yl)methanamine (PubChem CID 114729328) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-benzofuran-2-yl(2,3-dihydro-1H-inden-1-yl)methanamine.
| Compound Name | 1-benzofuran-2-yl(2,3-dihydro-1H-inden-1-yl)methanamine |
|---|---|
| PubChem CID | 114729328 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-benzofuran-2-yl(2,3-dihydro-1H-inden-1-yl)methanamine |
| SMILES | NC(c1cc2ccccc2o1)C1CCc2ccccc21 |
| InChI | InChI=1S/C18H17NO/c19-18(15-10-9-12-5-1-3-7-14(12)15)17-11-13-6-2-4-8-16(13)20-17/h1-8,11,15,18H,9-10,19H2 |
| InChIKey | IKGFNYMSERHJLV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |