C14H19N — CID 65403573
2-cyclopropyl-1-(2,3-dihydro-1H-inden-1-yl)ethanamine (PubChem CID 65403573) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-cyclopropyl-1-(2,3-dihydro-1H-inden-1-yl)ethanamine.
| Compound Name | 2-cyclopropyl-1-(2,3-dihydro-1H-inden-1-yl)ethanamine |
|---|---|
| PubChem CID | 65403573 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-cyclopropyl-1-(2,3-dihydro-1H-inden-1-yl)ethanamine |
| SMILES | NC(CC1CC1)C1CCc2ccccc21 |
| InChI | InChI=1S/C14H19N/c15-14(9-10-5-6-10)13-8-7-11-3-1-2-4-12(11)13/h1-4,10,13-14H,5-9,15H2 |
| InChIKey | BLFSYRAAKSHWIH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |