C18H27N — CID 65406297
2,3-dihydro-1H-inden-1-yl-(3-ethylcyclohexyl)methanamine (PubChem CID 65406297) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl-(3-ethylcyclohexyl)methanamine.
| Compound Name | 2,3-dihydro-1H-inden-1-yl-(3-ethylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 65406297 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl-(3-ethylcyclohexyl)methanamine |
| SMILES | CCC1CCCC(C(N)C2CCc3ccccc32)C1 |
| InChI | InChI=1S/C18H27N/c1-2-13-6-5-8-15(12-13)18(19)17-11-10-14-7-3-4-9-16(14)17/h3-4,7,9,13,15,17-18H,2,5-6,8,10-12,19H2,1H3 |
| InChIKey | DNLKQUBXNQLBMO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |