C18H28N2 — CID 105234438
[2,3-dihydro-1H-inden-1-yl-(2-ethylcyclohexyl)methyl]hydrazine (PubChem CID 105234438) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is [2,3-dihydro-1H-inden-1-yl-(2-ethylcyclohexyl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1H-inden-1-yl-(2-ethylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105234438 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | [2,3-dihydro-1H-inden-1-yl-(2-ethylcyclohexyl)methyl]hydrazine |
| SMILES | CCC1CCCCC1C(NN)C1CCc2ccccc21 |
| InChI | InChI=1S/C18H28N2/c1-2-13-7-3-6-10-16(13)18(20-19)17-12-11-14-8-4-5-9-15(14)17/h4-5,8-9,13,16-18,20H,2-3,6-7,10-12,19H2,1H3 |
| InChIKey | VSOIQQMMWPAPAE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|