C16H32N2 — CID 105309737
[(2-ethylcyclohexyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine (PubChem CID 105309737) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is [(2-ethylcyclohexyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine.
| Compound Name | [(2-ethylcyclohexyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105309737 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | [(2-ethylcyclohexyl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine |
| SMILES | CCC1CCCCC1C(NN)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H32N2/c1-6-11-9-7-8-10-12(11)13(18-17)14-15(2,3)16(14,4)5/h11-14,18H,6-10,17H2,1-5H3 |
| InChIKey | ZLBZNJLOPQASME-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|