C15H32N2O — CID 105273460
[1-(2-ethylcyclohexyl)-2-methoxy-3,3-dimethylbutyl]hydrazine (PubChem CID 105273460) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is [1-(2-ethylcyclohexyl)-2-methoxy-3,3-dimethylbutyl]hydrazine.
| Compound Name | [1-(2-ethylcyclohexyl)-2-methoxy-3,3-dimethylbutyl]hydrazine |
|---|---|
| PubChem CID | 105273460 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | [1-(2-ethylcyclohexyl)-2-methoxy-3,3-dimethylbutyl]hydrazine |
| SMILES | CCC1CCCCC1C(NN)C(OC)C(C)(C)C |
| InChI | InChI=1S/C15H32N2O/c1-6-11-9-7-8-10-12(11)13(17-16)14(18-5)15(2,3)4/h11-14,17H,6-10,16H2,1-5H3 |
| InChIKey | SCNQIFTVPAORRU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|