C18H15FO2 — CID 114726719
2,3-dihydro-1H-inden-1-yl-(7-fluoro-1-benzofuran-2-yl)methanol (PubChem CID 114726719) has the molecular formula C18H15FO2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl-(7-fluoro-1-benzofuran-2-yl)methanol.
| Compound Name | 2,3-dihydro-1H-inden-1-yl-(7-fluoro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 114726719 |
| Molecular Formula | C18H15FO2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl-(7-fluoro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc2cccc(F)c2o1)C1CCc2ccccc21 |
| InChI | InChI=1S/C18H15FO2/c19-15-7-3-5-12-10-16(21-18(12)15)17(20)14-9-8-11-4-1-2-6-13(11)14/h1-7,10,14,17,20H,8-9H2 |
| InChIKey | IPDSCRCJJTZGDF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |