C15H15F3O2 — CID 105130101
(4,4-difluorocyclohexyl)-(7-fluoro-1-benzofuran-2-yl)methanol (PubChem CID 105130101) has the molecular formula C15H15F3O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(7-fluoro-1-benzofuran-2-yl)methanol.
| Compound Name | (4,4-difluorocyclohexyl)-(7-fluoro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 105130101 |
| Molecular Formula | C15H15F3O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(7-fluoro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc2cccc(F)c2o1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H15F3O2/c16-11-3-1-2-10-8-12(20-14(10)11)13(19)9-4-6-15(17,18)7-5-9/h1-3,8-9,13,19H,4-7H2 |
| InChIKey | NPRZVCDJUQGTCM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |