C16H19FO2 — CID 114724076
(7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methanol (PubChem CID 114724076) has the molecular formula C16H19FO2 and a molecular weight of 262.32 g/mol. Its IUPAC name is (7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methanol.
| Compound Name | (7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 114724076 |
| Molecular Formula | C16H19FO2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methanol |
| SMILES | CC1CCCC(C(O)c2cc3cccc(F)c3o2)C1 |
| InChI | InChI=1S/C16H19FO2/c1-10-4-2-5-11(8-10)15(18)14-9-12-6-3-7-13(17)16(12)19-14/h3,6-7,9-11,15,18H,2,4-5,8H2,1H3 |
| InChIKey | KTCMTQOOKAAGFB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |