C18H24FNO — CID 114728259
N-[(7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methyl]ethanamine (PubChem CID 114728259) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is N-[(7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methyl]ethanamine.
| Compound Name | N-[(7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114728259 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[(7-fluoro-1-benzofuran-2-yl)-(3-methylcyclohexyl)methyl]ethanamine |
| SMILES | CCNC(c1cc2cccc(F)c2o1)C1CCCC(C)C1 |
| InChI | InChI=1S/C18H24FNO/c1-3-20-17(13-7-4-6-12(2)10-13)16-11-14-8-5-9-15(19)18(14)21-16/h5,8-9,11-13,17,20H,3-4,6-7,10H2,1-2H3 |
| InChIKey | IHLVFEIJMFWCNQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |