C14H15ClO2 — CID 114723689
(7-chloro-1-benzofuran-2-yl)-cyclopentylmethanol (PubChem CID 114723689) has the molecular formula C14H15ClO2 and a molecular weight of 250.72 g/mol. Its IUPAC name is (7-chloro-1-benzofuran-2-yl)-cyclopentylmethanol.
| Compound Name | (7-chloro-1-benzofuran-2-yl)-cyclopentylmethanol |
|---|---|
| PubChem CID | 114723689 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (7-chloro-1-benzofuran-2-yl)-cyclopentylmethanol |
| SMILES | OC(c1cc2cccc(Cl)c2o1)C1CCCC1 |
| InChI | InChI=1S/C14H15ClO2/c15-11-7-3-6-10-8-12(17-14(10)11)13(16)9-4-1-2-5-9/h3,6-9,13,16H,1-2,4-5H2 |
| InChIKey | LLORJVCCHBHNPV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |